C18H32OS — CID 176896709
(9Z,11E)-octadeca-9,11-dienethioic S-acid (PubChem CID 176896709) has the molecular formula C18H32OS and a molecular weight of 296.52 g/mol. Its IUPAC name is (9Z,11E)-octadeca-9,11-dienethioic S-acid.
| Compound Name | (9Z,11E)-octadeca-9,11-dienethioic S-acid |
|---|---|
| PubChem CID | 176896709 |
| Molecular Formula | C18H32OS |
| Molecular Weight | 296.52 g/mol |
| Exact Mass | 296.22 |
| IUPAC Name | (9Z,11E)-octadeca-9,11-dienethioic S-acid |
| SMILES | CCCCCC/C=C/C=C\CCCCCCCC(=O)S |
| InChI | InChI=1S/C18H32OS/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h7-10H,2-6,11-17H2,1H3,(H,19,20)/b8-7+,10-9- |
| InChIKey | VGKJZHHELNMOID-GOJKSUSPSA-N |
| XLogP | 6.26 |
| TPSA | 17.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.52 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|