C18H31KO2 — CID 101366415
potassium (10E,12E)-octadeca-10,12-dienoate (PubChem CID 101366415) has the molecular formula C18H31KO2 and a molecular weight of 318.54 g/mol. Its IUPAC name is potassium (10E,12E)-octadeca-10,12-dienoate.
| Compound Name | potassium (10E,12E)-octadeca-10,12-dienoate |
|---|---|
| PubChem CID | 101366415 |
| Molecular Formula | C18H31KO2 |
| Molecular Weight | 318.54 g/mol |
| Exact Mass | 318.20 |
| IUPAC Name | potassium (10E,12E)-octadeca-10,12-dienoate |
| SMILES | CCCCC/C=C/C=C/CCCCCCCCC(=O)[O-].[K+] |
| InChI | InChI=1S/C18H32O2.K/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;/h6-9H,2-5,10-17H2,1H3,(H,19,20);/q;+1/p-1/b7-6+,9-8+; |
| InChIKey | SLFOLIUKJJDAPO-QQPZBMOZSA-M |
| XLogP | 1.55 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.54 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|