About octadec-9-enamide
octadec-9-enamide (PubChem CID 75990485) has the molecular formula C36H70N2O2
and a molecular weight of 562.97 g/mol. Its IUPAC name is octadec-9-enamide.
Molecular Properties
| Compound Name | octadec-9-enamide |
| PubChem CID | 75990485 |
| Molecular Formula | C36H70N2O2 |
| Molecular Weight | 562.97 g/mol |
| Exact Mass | 562.54 |
| IUPAC Name | octadec-9-enamide |
| SMILES | CCCCCCCCC=CCCCCCCCC(N)=O.CCCCCCCCC=CCCCCCCCC(N)=O |
| InChI | InChI=1S/2C18H35NO/c2*1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h2*9-10H,2-8,11-17H2,1H3,(H2,19,20) |
| InChIKey | QPUQNFRDMXWYKM-UHFFFAOYSA-N |
| XLogP | 11.02 |
| TPSA | 86.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 40 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 562.97 |
| LogP ≤ 5 | 11.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze octadec-9-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of octadec-9-enamide?
The IUPAC name of octadec-9-enamide (CID 75990485) is octadec-9-enamide.
What is the SMILES notation for octadec-9-enamide?
The canonical SMILES for octadec-9-enamide is CCCCCCCCC=CCCCCCCCC(N)=O.CCCCCCCCC=CCCCCCCCC(N)=O.
What is the InChIKey of octadec-9-enamide?
The InChIKey is QPUQNFRDMXWYKM-UHFFFAOYSA-N. The full InChI is InChI=1S/2C18H35NO/c2*1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h2*9-10H,2-8,11-17H2,1H3,(H2,19,20).
What are the key properties of octadec-9-enamide?
octadec-9-enamide has a molecular weight of 562.97 g/mol, XLogP of 11.02, 30 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for octadec-9-enamide is sourced from PubChem (CID 75990485), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).