About (Z)-octadec-9-enamide;propan-1-ol
(Z)-octadec-9-enamide;propan-1-ol (PubChem CID 174914657) has the molecular formula C21H43NO2
and a molecular weight of 341.58 g/mol. Its IUPAC name is (Z)-octadec-9-enamide;propan-1-ol.
Molecular Properties
| Compound Name | (Z)-octadec-9-enamide;propan-1-ol |
| PubChem CID | 174914657 |
| Molecular Formula | C21H43NO2 |
| Molecular Weight | 341.58 g/mol |
| Exact Mass | 341.33 |
| IUPAC Name | (Z)-octadec-9-enamide;propan-1-ol |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(N)=O.CCCO |
| InChI | InChI=1S/C18H35NO.C3H8O/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;1-2-3-4/h9-10H,2-8,11-17H2,1H3,(H2,19,20);4H,2-3H2,1H3/b10-9-; |
| InChIKey | SPTNFDJZSKYKPL-KVVVOXFISA-N |
| XLogP | 5.90 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 341.58 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (Z)-octadec-9-enamide;propan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-octadec-9-enamide;propan-1-ol?
The IUPAC name of (Z)-octadec-9-enamide;propan-1-ol (CID 174914657) is (Z)-octadec-9-enamide;propan-1-ol.
What is the SMILES notation for (Z)-octadec-9-enamide;propan-1-ol?
The canonical SMILES for (Z)-octadec-9-enamide;propan-1-ol is CCCCCCCC/C=C\CCCCCCCC(N)=O.CCCO.
What is the InChIKey of (Z)-octadec-9-enamide;propan-1-ol?
The InChIKey is SPTNFDJZSKYKPL-KVVVOXFISA-N. The full InChI is InChI=1S/C18H35NO.C3H8O/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;1-2-3-4/h9-10H,2-8,11-17H2,1H3,(H2,19,20);4H,2-3H2,1H3/b10-9-;.
What are the key properties of (Z)-octadec-9-enamide;propan-1-ol?
(Z)-octadec-9-enamide;propan-1-ol has a molecular weight of 341.58 g/mol, XLogP of 5.90, 16 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-octadec-9-enamide;propan-1-ol is sourced from PubChem (CID 174914657), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).