About octadec-8-enamide
octadec-8-enamide (PubChem CID 57212690) has the molecular formula C18H35NO
and a molecular weight of 281.48 g/mol. Its IUPAC name is octadec-8-enamide.
Molecular Properties
| Compound Name | octadec-8-enamide |
| PubChem CID | 57212690 |
| Molecular Formula | C18H35NO |
| Molecular Weight | 281.48 g/mol |
| Exact Mass | 281.27 |
| IUPAC Name | octadec-8-enamide |
| SMILES | CCCCCCCCCC=CCCCCCCC(N)=O |
| InChI | InChI=1S/C18H35NO/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h10-11H,2-9,12-17H2,1H3,(H2,19,20) |
| InChIKey | RVDPDXRDNDUJHE-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 281.48 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze octadec-8-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of octadec-8-enamide?
The IUPAC name of octadec-8-enamide (CID 57212690) is octadec-8-enamide.
What is the SMILES notation for octadec-8-enamide?
The canonical SMILES for octadec-8-enamide is CCCCCCCCCC=CCCCCCCC(N)=O.
What is the InChIKey of octadec-8-enamide?
The InChIKey is RVDPDXRDNDUJHE-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H35NO/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h10-11H,2-9,12-17H2,1H3,(H2,19,20).
What are the key properties of octadec-8-enamide?
octadec-8-enamide has a molecular weight of 281.48 g/mol, XLogP of 5.51, 15 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for octadec-8-enamide is sourced from PubChem (CID 57212690), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).