About calcium;(Z)-octadec-9-enamide;carbonate
calcium;(Z)-octadec-9-enamide;carbonate (PubChem CID 87780196) has the molecular formula C19H35CaNO4
and a molecular weight of 381.57 g/mol. Its IUPAC name is calcium;(Z)-octadec-9-enamide;carbonate.
Molecular Properties
| Compound Name | calcium;(Z)-octadec-9-enamide;carbonate |
| PubChem CID | 87780196 |
| Molecular Formula | C19H35CaNO4 |
| Molecular Weight | 381.57 g/mol |
| Exact Mass | 381.22 |
| IUPAC Name | calcium;(Z)-octadec-9-enamide;carbonate |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(N)=O.O=C([O-])[O-].[Ca+2] |
| InChI | InChI=1S/C18H35NO.CH2O3.Ca/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;2-1(3)4;/h9-10H,2-8,11-17H2,1H3,(H2,19,20);(H2,2,3,4);/q;;+2/p-2/b10-9-;; |
| InChIKey | WLLPSELNAYQTBV-XXAVUKJNSA-L |
| XLogP | 2.68 |
| TPSA | 106.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 381.57 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze calcium;(Z)-octadec-9-enamide;carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of calcium;(Z)-octadec-9-enamide;carbonate?
The IUPAC name of calcium;(Z)-octadec-9-enamide;carbonate (CID 87780196) is calcium;(Z)-octadec-9-enamide;carbonate.
What is the SMILES notation for calcium;(Z)-octadec-9-enamide;carbonate?
The canonical SMILES for calcium;(Z)-octadec-9-enamide;carbonate is CCCCCCCC/C=C\CCCCCCCC(N)=O.O=C([O-])[O-].[Ca+2].
What is the InChIKey of calcium;(Z)-octadec-9-enamide;carbonate?
The InChIKey is WLLPSELNAYQTBV-XXAVUKJNSA-L. The full InChI is InChI=1S/C18H35NO.CH2O3.Ca/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;2-1(3)4;/h9-10H,2-8,11-17H2,1H3,(H2,19,20);(H2,2,3,4);/q;;+2/p-2/b10-9-;;.
What are the key properties of calcium;(Z)-octadec-9-enamide;carbonate?
calcium;(Z)-octadec-9-enamide;carbonate has a molecular weight of 381.57 g/mol, XLogP of 2.68, 15 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for calcium;(Z)-octadec-9-enamide;carbonate is sourced from PubChem (CID 87780196), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).