About ethanamine;(Z)-octadec-9-enamide
ethanamine;(Z)-octadec-9-enamide (PubChem CID 174881781) has the molecular formula C20H42N2O
and a molecular weight of 326.57 g/mol. Its IUPAC name is ethanamine;(Z)-octadec-9-enamide.
Molecular Properties
| Compound Name | ethanamine;(Z)-octadec-9-enamide |
| PubChem CID | 174881781 |
| Molecular Formula | C20H42N2O |
| Molecular Weight | 326.57 g/mol |
| Exact Mass | 326.33 |
| IUPAC Name | ethanamine;(Z)-octadec-9-enamide |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(N)=O.CCN |
| InChI | InChI=1S/C18H35NO.C2H7N/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;1-2-3/h9-10H,2-8,11-17H2,1H3,(H2,19,20);2-3H2,1H3/b10-9-; |
| InChIKey | YZOUKCNCXOWLEO-KVVVOXFISA-N |
| XLogP | 5.47 |
| TPSA | 69.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 326.57 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze ethanamine;(Z)-octadec-9-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethanamine;(Z)-octadec-9-enamide?
The IUPAC name of ethanamine;(Z)-octadec-9-enamide (CID 174881781) is ethanamine;(Z)-octadec-9-enamide.
What is the SMILES notation for ethanamine;(Z)-octadec-9-enamide?
The canonical SMILES for ethanamine;(Z)-octadec-9-enamide is CCCCCCCC/C=C\CCCCCCCC(N)=O.CCN.
What is the InChIKey of ethanamine;(Z)-octadec-9-enamide?
The InChIKey is YZOUKCNCXOWLEO-KVVVOXFISA-N. The full InChI is InChI=1S/C18H35NO.C2H7N/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;1-2-3/h9-10H,2-8,11-17H2,1H3,(H2,19,20);2-3H2,1H3/b10-9-;.
What are the key properties of ethanamine;(Z)-octadec-9-enamide?
ethanamine;(Z)-octadec-9-enamide has a molecular weight of 326.57 g/mol, XLogP of 5.47, 15 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethanamine;(Z)-octadec-9-enamide is sourced from PubChem (CID 174881781), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).