About bis((Z)-hexadec-9-enamide);prop-1-ene
bis((Z)-hexadec-9-enamide);prop-1-ene (PubChem CID 158850340) has the molecular formula C35H68N2O2
and a molecular weight of 548.94 g/mol. Its IUPAC name is bis((Z)-hexadec-9-enamide);prop-1-ene.
Molecular Properties
| Compound Name | bis((Z)-hexadec-9-enamide);prop-1-ene |
| PubChem CID | 158850340 |
| Molecular Formula | C35H68N2O2 |
| Molecular Weight | 548.94 g/mol |
| Exact Mass | 548.53 |
| IUPAC Name | bis((Z)-hexadec-9-enamide);prop-1-ene |
| SMILES | C=CC.CCCCCC/C=C\CCCCCCCC(N)=O.CCCCCC/C=C\CCCCCCCC(N)=O |
| InChI | InChI=1S/2C16H31NO.C3H6/c2*1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16(17)18;1-3-2/h2*7-8H,2-6,9-15H2,1H3,(H2,17,18);3H,1H2,2H3/b2*8-7-; |
| InChIKey | IZJDZGCBGZXAHA-ATMONBRVSA-N |
| XLogP | 10.65 |
| TPSA | 86.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 39 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 548.94 |
| LogP ≤ 5 | 10.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze bis((Z)-hexadec-9-enamide);prop-1-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis((Z)-hexadec-9-enamide);prop-1-ene?
The IUPAC name of bis((Z)-hexadec-9-enamide);prop-1-ene (CID 158850340) is bis((Z)-hexadec-9-enamide);prop-1-ene.
What is the SMILES notation for bis((Z)-hexadec-9-enamide);prop-1-ene?
The canonical SMILES for bis((Z)-hexadec-9-enamide);prop-1-ene is C=CC.CCCCCC/C=C\CCCCCCCC(N)=O.CCCCCC/C=C\CCCCCCCC(N)=O.
What is the InChIKey of bis((Z)-hexadec-9-enamide);prop-1-ene?
The InChIKey is IZJDZGCBGZXAHA-ATMONBRVSA-N. The full InChI is InChI=1S/2C16H31NO.C3H6/c2*1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16(17)18;1-3-2/h2*7-8H,2-6,9-15H2,1H3,(H2,17,18);3H,1H2,2H3/b2*8-7-;.
What are the key properties of bis((Z)-hexadec-9-enamide);prop-1-ene?
bis((Z)-hexadec-9-enamide);prop-1-ene has a molecular weight of 548.94 g/mol, XLogP of 10.65, 26 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for bis((Z)-hexadec-9-enamide);prop-1-ene is sourced from PubChem (CID 158850340), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).