About indigane;(Z)-octadec-9-enamide
indigane;(Z)-octadec-9-enamide (PubChem CID 174921402) has the molecular formula C18H38InNO
and a molecular weight of 399.33 g/mol. Its IUPAC name is indigane;(Z)-octadec-9-enamide.
Molecular Properties
| Compound Name | indigane;(Z)-octadec-9-enamide |
| PubChem CID | 174921402 |
| Molecular Formula | C18H38InNO |
| Molecular Weight | 399.33 g/mol |
| Exact Mass | 399.20 |
| IUPAC Name | indigane;(Z)-octadec-9-enamide |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(N)=O.[InH3] |
| InChI | InChI=1S/C18H35NO.In.3H/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;;;;/h9-10H,2-8,11-17H2,1H3,(H2,19,20);;;;/b10-9-;;;; |
| InChIKey | RLFIJDHXMZCMGR-HKIWRJGFSA-N |
| XLogP | 4.33 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 399.33 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze indigane;(Z)-octadec-9-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of indigane;(Z)-octadec-9-enamide?
The IUPAC name of indigane;(Z)-octadec-9-enamide (CID 174921402) is indigane;(Z)-octadec-9-enamide.
What is the SMILES notation for indigane;(Z)-octadec-9-enamide?
The canonical SMILES for indigane;(Z)-octadec-9-enamide is CCCCCCCC/C=C\CCCCCCCC(N)=O.[InH3].
What is the InChIKey of indigane;(Z)-octadec-9-enamide?
The InChIKey is RLFIJDHXMZCMGR-HKIWRJGFSA-N. The full InChI is InChI=1S/C18H35NO.In.3H/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;;;;/h9-10H,2-8,11-17H2,1H3,(H2,19,20);;;;/b10-9-;;;;.
What are the key properties of indigane;(Z)-octadec-9-enamide?
indigane;(Z)-octadec-9-enamide has a molecular weight of 399.33 g/mol, XLogP of 4.33, 15 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for indigane;(Z)-octadec-9-enamide is sourced from PubChem (CID 174921402), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).