About mercury;(Z)-octadec-9-enamide;hydrochloride
mercury;(Z)-octadec-9-enamide;hydrochloride (PubChem CID 175499195) has the molecular formula C18H36ClHgNO
and a molecular weight of 518.54 g/mol. Its IUPAC name is mercury;(Z)-octadec-9-enamide;hydrochloride.
Molecular Properties
| Compound Name | mercury;(Z)-octadec-9-enamide;hydrochloride |
| PubChem CID | 175499195 |
| Molecular Formula | C18H36ClHgNO |
| Molecular Weight | 518.54 g/mol |
| Exact Mass | 519.22 |
| IUPAC Name | mercury;(Z)-octadec-9-enamide;hydrochloride |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(N)=O.Cl.[Hg] |
| InChI | InChI=1S/C18H35NO.ClH.Hg/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;;/h9-10H,2-8,11-17H2,1H3,(H2,19,20);1H;/b10-9-;; |
| InChIKey | BJBOQSDCEXBCEF-XXAVUKJNSA-N |
| XLogP | 5.93 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 518.54 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze mercury;(Z)-octadec-9-enamide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of mercury;(Z)-octadec-9-enamide;hydrochloride?
The IUPAC name of mercury;(Z)-octadec-9-enamide;hydrochloride (CID 175499195) is mercury;(Z)-octadec-9-enamide;hydrochloride.
What is the SMILES notation for mercury;(Z)-octadec-9-enamide;hydrochloride?
The canonical SMILES for mercury;(Z)-octadec-9-enamide;hydrochloride is CCCCCCCC/C=C\CCCCCCCC(N)=O.Cl.[Hg].
What is the InChIKey of mercury;(Z)-octadec-9-enamide;hydrochloride?
The InChIKey is BJBOQSDCEXBCEF-XXAVUKJNSA-N. The full InChI is InChI=1S/C18H35NO.ClH.Hg/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;;/h9-10H,2-8,11-17H2,1H3,(H2,19,20);1H;/b10-9-;;.
What are the key properties of mercury;(Z)-octadec-9-enamide;hydrochloride?
mercury;(Z)-octadec-9-enamide;hydrochloride has a molecular weight of 518.54 g/mol, XLogP of 5.93, 15 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for mercury;(Z)-octadec-9-enamide;hydrochloride is sourced from PubChem (CID 175499195), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).