C21H46Cl2N2O — CID 174573210
N,N-dimethylmethanamine;(Z)-octadec-9-enamide;dihydrochloride (PubChem CID 174573210) has the molecular formula C21H46Cl2N2O and a molecular weight of 413.52 g/mol. Its IUPAC name is N,N-dimethylmethanamine;(Z)-octadec-9-enamide;dihydrochloride.
| Compound Name | N,N-dimethylmethanamine;(Z)-octadec-9-enamide;dihydrochloride |
|---|---|
| PubChem CID | 174573210 |
| Molecular Formula | C21H46Cl2N2O |
| Molecular Weight | 413.52 g/mol |
| Exact Mass | 412.30 |
| IUPAC Name | N,N-dimethylmethanamine;(Z)-octadec-9-enamide;dihydrochloride |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(N)=O.CN(C)C.Cl.Cl |
| InChI | InChI=1S/C18H35NO.C3H9N.2ClH/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;1-4(2)3;;/h9-10H,2-8,11-17H2,1H3,(H2,19,20);1-3H3;2*1H/b10-9-;;; |
| InChIKey | MESYNQRLLDPEHK-BZKIHGKGSA-N |
| XLogP | 6.53 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.52 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|