About (Z)-octadec-9-enamide;hydrobromide
(Z)-octadec-9-enamide;hydrobromide (PubChem CID 146504042) has the molecular formula C18H36BrNO
and a molecular weight of 362.40 g/mol. Its IUPAC name is (Z)-octadec-9-enamide;hydrobromide.
Molecular Properties
| Compound Name | (Z)-octadec-9-enamide;hydrobromide |
| PubChem CID | 146504042 |
| Molecular Formula | C18H36BrNO |
| Molecular Weight | 362.40 g/mol |
| Exact Mass | 361.20 |
| IUPAC Name | (Z)-octadec-9-enamide;hydrobromide |
| SMILES | Br.CCCCCCCC/C=C\CCCCCCCC(N)=O |
| InChI | InChI=1S/C18H35NO.BrH/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;/h9-10H,2-8,11-17H2,1H3,(H2,19,20);1H/b10-9-; |
| InChIKey | DBTONVIJCSBWKI-KVVVOXFISA-N |
| XLogP | 6.09 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 362.40 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (Z)-octadec-9-enamide;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-octadec-9-enamide;hydrobromide?
The IUPAC name of (Z)-octadec-9-enamide;hydrobromide (CID 146504042) is (Z)-octadec-9-enamide;hydrobromide.
What is the SMILES notation for (Z)-octadec-9-enamide;hydrobromide?
The canonical SMILES for (Z)-octadec-9-enamide;hydrobromide is Br.CCCCCCCC/C=C\CCCCCCCC(N)=O.
What is the InChIKey of (Z)-octadec-9-enamide;hydrobromide?
The InChIKey is DBTONVIJCSBWKI-KVVVOXFISA-N. The full InChI is InChI=1S/C18H35NO.BrH/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;/h9-10H,2-8,11-17H2,1H3,(H2,19,20);1H/b10-9-;.
What are the key properties of (Z)-octadec-9-enamide;hydrobromide?
(Z)-octadec-9-enamide;hydrobromide has a molecular weight of 362.40 g/mol, XLogP of 6.09, 15 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-octadec-9-enamide;hydrobromide is sourced from PubChem (CID 146504042), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).