C36H70O6 — CID 160959811
decanoic acid;(Z)-octadec-9-enoic acid;octanoic acid (PubChem CID 160959811) has the molecular formula C36H70O6 and a molecular weight of 598.95 g/mol. Its IUPAC name is decanoic acid;(Z)-octadec-9-enoic acid;octanoic acid.
| Compound Name | decanoic acid;(Z)-octadec-9-enoic acid;octanoic acid |
|---|---|
| PubChem CID | 160959811 |
| Molecular Formula | C36H70O6 |
| Molecular Weight | 598.95 g/mol |
| Exact Mass | 598.52 |
| IUPAC Name | decanoic acid;(Z)-octadec-9-enoic acid;octanoic acid |
| SMILES | CCCCCCCC(=O)O.CCCCCCCC/C=C\CCCCCCCC(=O)O.CCCCCCCCCC(=O)O |
| InChI | InChI=1S/C18H34O2.C10H20O2.C8H16O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;1-2-3-4-5-6-7-8-9-10(11)12;1-2-3-4-5-6-7-8(9)10/h9-10H,2-8,11-17H2,1H3,(H,19,20);2-9H2,1H3,(H,11,12);2-7H2,1H3,(H,9,10)/b10-9-;; |
| InChIKey | SWWFRSCRRMOJEM-XXAVUKJNSA-N |
| XLogP | 11.75 |
| TPSA | 111.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 29 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.95 |
| LogP ≤ 5 | 11.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|