About (E)-nonadec-12-en-9-one
(E)-nonadec-12-en-9-one (PubChem CID 15584258) has the molecular formula C19H36O
and a molecular weight of 280.50 g/mol. Its IUPAC name is (E)-nonadec-12-en-9-one.
Molecular Properties
| Compound Name | (E)-nonadec-12-en-9-one |
| PubChem CID | 15584258 |
| Molecular Formula | C19H36O |
| Molecular Weight | 280.50 g/mol |
| Exact Mass | 280.28 |
| IUPAC Name | (E)-nonadec-12-en-9-one |
| SMILES | CCCCCC/C=C/CCC(=O)CCCCCCCC |
| InChI | InChI=1S/C19H36O/c1-3-5-7-9-11-12-14-16-18-19(20)17-15-13-10-8-6-4-2/h12,14H,3-11,13,15-18H2,1-2H3/b14-12+ |
| InChIKey | LLUGFFSGUQULMF-WYMLVPIESA-N |
| XLogP | 6.61 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 280.50 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (E)-nonadec-12-en-9-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-nonadec-12-en-9-one?
The IUPAC name of (E)-nonadec-12-en-9-one (CID 15584258) is (E)-nonadec-12-en-9-one.
What is the SMILES notation for (E)-nonadec-12-en-9-one?
The canonical SMILES for (E)-nonadec-12-en-9-one is CCCCCC/C=C/CCC(=O)CCCCCCCC.
What is the InChIKey of (E)-nonadec-12-en-9-one?
The InChIKey is LLUGFFSGUQULMF-WYMLVPIESA-N. The full InChI is InChI=1S/C19H36O/c1-3-5-7-9-11-12-14-16-18-19(20)17-15-13-10-8-6-4-2/h12,14H,3-11,13,15-18H2,1-2H3/b14-12+.
What are the key properties of (E)-nonadec-12-en-9-one?
(E)-nonadec-12-en-9-one has a molecular weight of 280.50 g/mol, XLogP of 6.61, 15 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-nonadec-12-en-9-one is sourced from PubChem (CID 15584258), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).