C21H38O — CID 10946721
(12Z,15Z)-henicosa-12,15-dien-4-one (PubChem CID 10946721) has the molecular formula C21H38O and a molecular weight of 306.53 g/mol. Its IUPAC name is (12Z,15Z)-henicosa-12,15-dien-4-one.
| Compound Name | (12Z,15Z)-henicosa-12,15-dien-4-one |
|---|---|
| PubChem CID | 10946721 |
| Molecular Formula | C21H38O |
| Molecular Weight | 306.53 g/mol |
| Exact Mass | 306.29 |
| IUPAC Name | (12Z,15Z)-henicosa-12,15-dien-4-one |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCC(=O)CCC |
| InChI | InChI=1S/C21H38O/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-17-18-20-21(22)19-4-2/h8-9,11-12H,3-7,10,13-20H2,1-2H3/b9-8-,12-11- |
| InChIKey | XCPAOBADLUZDRY-MURFETPASA-N |
| XLogP | 7.17 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.53 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|