C20H34O3 — CID 123247176
3-oxoicosa-11,14-dienoic acid (PubChem CID 123247176) has the molecular formula C20H34O3 and a molecular weight of 322.49 g/mol. Its IUPAC name is 3-oxoicosa-11,14-dienoic acid.
| Compound Name | 3-oxoicosa-11,14-dienoic acid |
|---|---|
| PubChem CID | 123247176 |
| Molecular Formula | C20H34O3 |
| Molecular Weight | 322.49 g/mol |
| Exact Mass | 322.25 |
| IUPAC Name | 3-oxoicosa-11,14-dienoic acid |
| SMILES | CCCCCC=CCC=CCCCCCCCC(=O)CC(=O)O |
| InChI | InChI=1S/C20H34O3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-19(21)18-20(22)23/h6-7,9-10H,2-5,8,11-18H2,1H3,(H,22,23) |
| InChIKey | UMWCSRYIUBSEOG-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.49 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|