C24H40O2 — CID 75955148
tetracosa-9,12,15,18-tetraenoic acid (PubChem CID 75955148) has the molecular formula C24H40O2 and a molecular weight of 360.58 g/mol. Its IUPAC name is tetracosa-9,12,15,18-tetraenoic acid.
| Compound Name | tetracosa-9,12,15,18-tetraenoic acid |
|---|---|
| PubChem CID | 75955148 |
| Molecular Formula | C24H40O2 |
| Molecular Weight | 360.58 g/mol |
| Exact Mass | 360.30 |
| IUPAC Name | tetracosa-9,12,15,18-tetraenoic acid |
| SMILES | CCCCCC=CCC=CCC=CCC=CCCCCCCCC(=O)O |
| InChI | InChI=1S/C24H40O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-24(25)26/h6-7,9-10,12-13,15-16H,2-5,8,11,14,17-23H2,1H3,(H,25,26) |
| InChIKey | MMJZTSLHOIGZPU-UHFFFAOYSA-N |
| XLogP | 7.78 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.58 |
| LogP ≤ 5 | 7.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|