(9Z,12Z,15Z,18Z)-tetracosa-9,12,15,18-tetraenoic acid

C24H40O2 — CID 52921800

IUPAC(9Z,12Z,15Z,18Z)-tetracosa-9,12,15,18-tetraenoic acid
SMILESCCCCC/C=C\C/C=C\C/C=C\C/C=C\CCCCCCCC(=O)O
InChIInChI=1S/C24H40O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-24(25)26/h6-7,9-10,12-13,15-16H,2-5,8,11,14,17-23H2,1H3,(H,25,26)/b7-6-,10-9-,13-12-,16-15-
InChIKeyMMJZTSLHOIGZPU-DOFZRALJSA-N
MW360.58 g/mol
LogP7.78
Rot. Bonds18

About (9Z,12Z,15Z,18Z)-tetracosa-9,12,15,18-tetraenoic acid

(9Z,12Z,15Z,18Z)-tetracosa-9,12,15,18-tetraenoic acid (PubChem CID 52921800) has the molecular formula C24H40O2 and a molecular weight of 360.58 g/mol. Its IUPAC name is (9Z,12Z,15Z,18Z)-tetracosa-9,12,15,18-tetraenoic acid.

Molecular Properties

Compound Name(9Z,12Z,15Z,18Z)-tetracosa-9,12,15,18-tetraenoic acid
PubChem CID52921800
Molecular FormulaC24H40O2
Molecular Weight360.58 g/mol
Exact Mass360.30
IUPAC Name(9Z,12Z,15Z,18Z)-tetracosa-9,12,15,18-tetraenoic acid
SMILESCCCCC/C=C\C/C=C\C/C=C\C/C=C\CCCCCCCC(=O)O
InChIInChI=1S/C24H40O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-24(25)26/h6-7,9-10,12-13,15-16H,2-5,8,11,14,17-23H2,1H3,(H,25,26)/b7-6-,10-9-,13-12-,16-15-
InChIKeyMMJZTSLHOIGZPU-DOFZRALJSA-N
XLogP7.78
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds18
Heavy Atoms26
Complexity

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500360.58
LogP ≤ 57.78
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}

Analyze (9Z,12Z,15Z,18Z)-tetracosa-9,12,15,18-tetraenoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (9Z,12Z,15Z,18Z)-tetracosa-9,12,15,18-tetraenoic acid?
The IUPAC name of (9Z,12Z,15Z,18Z)-tetracosa-9,12,15,18-tetraenoic acid (CID 52921800) is (9Z,12Z,15Z,18Z)-tetracosa-9,12,15,18-tetraenoic acid.
What is the SMILES notation for (9Z,12Z,15Z,18Z)-tetracosa-9,12,15,18-tetraenoic acid?
The canonical SMILES for (9Z,12Z,15Z,18Z)-tetracosa-9,12,15,18-tetraenoic acid is CCCCC/C=C\C/C=C\C/C=C\C/C=C\CCCCCCCC(=O)O.
What is the InChIKey of (9Z,12Z,15Z,18Z)-tetracosa-9,12,15,18-tetraenoic acid?
The InChIKey is MMJZTSLHOIGZPU-DOFZRALJSA-N. The full InChI is InChI=1S/C24H40O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-24(25)26/h6-7,9-10,12-13,15-16H,2-5,8,11,14,17-23H2,1H3,(H,25,26)/b7-6-,10-9-,13-12-,16-15-.
What are the key properties of (9Z,12Z,15Z,18Z)-tetracosa-9,12,15,18-tetraenoic acid?
(9Z,12Z,15Z,18Z)-tetracosa-9,12,15,18-tetraenoic acid has a molecular weight of 360.58 g/mol, XLogP of 7.78, 18 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (9Z,12Z,15Z,18Z)-tetracosa-9,12,15,18-tetraenoic acid is sourced from PubChem (CID 52921800), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).