C22H38O2 — CID 52922002
(7Z,13Z,16Z)-docosa-7,13,16-trienoic acid (PubChem CID 52922002) has the molecular formula C22H38O2 and a molecular weight of 334.54 g/mol. Its IUPAC name is (7Z,13Z,16Z)-docosa-7,13,16-trienoic acid.
| Compound Name | (7Z,13Z,16Z)-docosa-7,13,16-trienoic acid |
|---|---|
| PubChem CID | 52922002 |
| Molecular Formula | C22H38O2 |
| Molecular Weight | 334.54 g/mol |
| Exact Mass | 334.29 |
| IUPAC Name | (7Z,13Z,16Z)-docosa-7,13,16-trienoic acid |
| SMILES | CCCCC/C=C\C/C=C\CCCC/C=C\CCCCCC(=O)O |
| InChI | InChI=1S/C22H38O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22(23)24/h6-7,9-10,15-16H,2-5,8,11-14,17-21H2,1H3,(H,23,24)/b7-6-,10-9-,16-15- |
| InChIKey | GUHKSOUIJGCNGR-URZBRJKDSA-N |
| XLogP | 7.22 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.54 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|