About heptadec-2-en-7-one
heptadec-2-en-7-one (PubChem CID 54227331) has the molecular formula C17H32O
and a molecular weight of 252.44 g/mol. Its IUPAC name is heptadec-2-en-7-one.
Molecular Properties
| Compound Name | heptadec-2-en-7-one |
| PubChem CID | 54227331 |
| Molecular Formula | C17H32O |
| Molecular Weight | 252.44 g/mol |
| Exact Mass | 252.25 |
| IUPAC Name | heptadec-2-en-7-one |
| SMILES | CC=CCCCC(=O)CCCCCCCCCC |
| InChI | InChI=1S/C17H32O/c1-3-5-7-9-10-11-12-14-16-17(18)15-13-8-6-4-2/h4,6H,3,5,7-16H2,1-2H3 |
| InChIKey | QGTVZZORTUFTDQ-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 252.44 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze heptadec-2-en-7-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of heptadec-2-en-7-one?
The IUPAC name of heptadec-2-en-7-one (CID 54227331) is heptadec-2-en-7-one.
What is the SMILES notation for heptadec-2-en-7-one?
The canonical SMILES for heptadec-2-en-7-one is CC=CCCCC(=O)CCCCCCCCCC.
What is the InChIKey of heptadec-2-en-7-one?
The InChIKey is QGTVZZORTUFTDQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H32O/c1-3-5-7-9-10-11-12-14-16-17(18)15-13-8-6-4-2/h4,6H,3,5,7-16H2,1-2H3.
What are the key properties of heptadec-2-en-7-one?
heptadec-2-en-7-one has a molecular weight of 252.44 g/mol, XLogP of 5.83, 13 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for heptadec-2-en-7-one is sourced from PubChem (CID 54227331), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).