About undec-2-en-6-one;hydrochloride
undec-2-en-6-one;hydrochloride (PubChem CID 175086863) has the molecular formula C11H21ClO
and a molecular weight of 204.74 g/mol. Its IUPAC name is undec-2-en-6-one;hydrochloride.
Molecular Properties
| Compound Name | undec-2-en-6-one;hydrochloride |
| PubChem CID | 175086863 |
| Molecular Formula | C11H21ClO |
| Molecular Weight | 204.74 g/mol |
| Exact Mass | 204.13 |
| IUPAC Name | undec-2-en-6-one;hydrochloride |
| SMILES | CC=CCCC(=O)CCCCC.Cl |
| InChI | InChI=1S/C11H20O.ClH/c1-3-5-7-9-11(12)10-8-6-4-2;/h3,5H,4,6-10H2,1-2H3;1H |
| InChIKey | RBGAPRGPWBETTF-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.74 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze undec-2-en-6-one;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of undec-2-en-6-one;hydrochloride?
The IUPAC name of undec-2-en-6-one;hydrochloride (CID 175086863) is undec-2-en-6-one;hydrochloride.
What is the SMILES notation for undec-2-en-6-one;hydrochloride?
The canonical SMILES for undec-2-en-6-one;hydrochloride is CC=CCCC(=O)CCCCC.Cl.
What is the InChIKey of undec-2-en-6-one;hydrochloride?
The InChIKey is RBGAPRGPWBETTF-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20O.ClH/c1-3-5-7-9-11(12)10-8-6-4-2;/h3,5H,4,6-10H2,1-2H3;1H.
What are the key properties of undec-2-en-6-one;hydrochloride?
undec-2-en-6-one;hydrochloride has a molecular weight of 204.74 g/mol, XLogP of 3.91, 7 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for undec-2-en-6-one;hydrochloride is sourced from PubChem (CID 175086863), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).