C21H39NO3 — CID 53324035
(E)-N-[(2R)-1-hydroxypropan-2-yl]-10-oxooctadec-8-enamide (PubChem CID 53324035) has the molecular formula C21H39NO3 and a molecular weight of 353.55 g/mol. Its IUPAC name is (E)-N-[(2R)-1-hydroxypropan-2-yl]-10-oxooctadec-8-enamide.
| Compound Name | (E)-N-[(2R)-1-hydroxypropan-2-yl]-10-oxooctadec-8-enamide |
|---|---|
| PubChem CID | 53324035 |
| Molecular Formula | C21H39NO3 |
| Molecular Weight | 353.55 g/mol |
| Exact Mass | 353.29 |
| IUPAC Name | (E)-N-[(2R)-1-hydroxypropan-2-yl]-10-oxooctadec-8-enamide |
| SMILES | CCCCCCCCC(=O)/C=C/CCCCCCC(=O)N[C@H](C)CO |
| InChI | InChI=1S/C21H39NO3/c1-3-4-5-6-9-12-15-20(24)16-13-10-7-8-11-14-17-21(25)22-19(2)18-23/h13,16,19,23H,3-12,14-15,17-18H2,1-2H3,(H,22,25)/b16-13+/t19-/m1/s1 |
| InChIKey | BBPXIDANKBZMAW-NRMGUKERSA-N |
| XLogP | 4.70 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.55 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|