C21H41NO2 — CID 66509136
(E)-N-[(2S)-1-hydroxypropan-2-yl]octadec-9-enamide (PubChem CID 66509136) has the molecular formula C21H41NO2 and a molecular weight of 339.56 g/mol. Its IUPAC name is (E)-N-[(2S)-1-hydroxypropan-2-yl]octadec-9-enamide.
| Compound Name | (E)-N-[(2S)-1-hydroxypropan-2-yl]octadec-9-enamide |
|---|---|
| PubChem CID | 66509136 |
| Molecular Formula | C21H41NO2 |
| Molecular Weight | 339.56 g/mol |
| Exact Mass | 339.31 |
| IUPAC Name | (E)-N-[(2S)-1-hydroxypropan-2-yl]octadec-9-enamide |
| SMILES | CCCCCCCC/C=C/CCCCCCCC(=O)N[C@@H](C)CO |
| InChI | InChI=1S/C21H41NO2/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-21(24)22-20(2)19-23/h10-11,20,23H,3-9,12-19H2,1-2H3,(H,22,24)/b11-10+/t20-/m0/s1 |
| InChIKey | IPVYNYWIRWMRHH-CFGKVWFZSA-N |
| XLogP | 5.52 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.56 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|