C14H26 — CID 144930771
(E,4E)-4-ethylidenedodec-2-ene (PubChem CID 144930771) has the molecular formula C14H26 and a molecular weight of 194.36 g/mol. Its IUPAC name is (E,4E)-4-ethylidenedodec-2-ene.
| Compound Name | (E,4E)-4-ethylidenedodec-2-ene |
|---|---|
| PubChem CID | 144930771 |
| Molecular Formula | C14H26 |
| Molecular Weight | 194.36 g/mol |
| Exact Mass | 194.20 |
| IUPAC Name | (E,4E)-4-ethylidenedodec-2-ene |
| SMILES | C/C=C/C(=C/C)CCCCCCCC |
| InChI | InChI=1S/C14H26/c1-4-7-8-9-10-11-13-14(6-3)12-5-2/h5-6,12H,4,7-11,13H2,1-3H3/b12-5+,14-6- |
| InChIKey | GSGMDPZCHRXLFU-GQZZKPIESA-N |
| XLogP | 5.26 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.36 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|