About but-2-ene;octadecanoic acid
but-2-ene;octadecanoic acid (PubChem CID 174621561) has the molecular formula C22H44O2
and a molecular weight of 340.59 g/mol. Its IUPAC name is but-2-ene;octadecanoic acid.
Molecular Properties
| Compound Name | but-2-ene;octadecanoic acid |
| PubChem CID | 174621561 |
| Molecular Formula | C22H44O2 |
| Molecular Weight | 340.59 g/mol |
| Exact Mass | 340.33 |
| IUPAC Name | but-2-ene;octadecanoic acid |
| SMILES | CC=CC.CCCCCCCCCCCCCCCCCC(=O)O |
| InChI | InChI=1S/C18H36O2.C4H8/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;1-3-4-2/h2-17H2,1H3,(H,19,20);3-4H,1-2H3 |
| InChIKey | UCZZHNRSURLULC-UHFFFAOYSA-N |
| XLogP | 7.91 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 340.59 |
| LogP ≤ 5 | 7.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze but-2-ene;octadecanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of but-2-ene;octadecanoic acid?
The IUPAC name of but-2-ene;octadecanoic acid (CID 174621561) is but-2-ene;octadecanoic acid.
What is the SMILES notation for but-2-ene;octadecanoic acid?
The canonical SMILES for but-2-ene;octadecanoic acid is CC=CC.CCCCCCCCCCCCCCCCCC(=O)O.
What is the InChIKey of but-2-ene;octadecanoic acid?
The InChIKey is UCZZHNRSURLULC-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H36O2.C4H8/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;1-3-4-2/h2-17H2,1H3,(H,19,20);3-4H,1-2H3.
What are the key properties of but-2-ene;octadecanoic acid?
but-2-ene;octadecanoic acid has a molecular weight of 340.59 g/mol, XLogP of 7.91, 16 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for but-2-ene;octadecanoic acid is sourced from PubChem (CID 174621561), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).