C14H24 — CID 143713569
(3Z,5Z)-5-ethylidenedodeca-1,3-diene (PubChem CID 143713569) has the molecular formula C14H24 and a molecular weight of 192.35 g/mol. Its IUPAC name is (3Z,5Z)-5-ethylidenedodeca-1,3-diene.
| Compound Name | (3Z,5Z)-5-ethylidenedodeca-1,3-diene |
|---|---|
| PubChem CID | 143713569 |
| Molecular Formula | C14H24 |
| Molecular Weight | 192.35 g/mol |
| Exact Mass | 192.19 |
| IUPAC Name | (3Z,5Z)-5-ethylidenedodeca-1,3-diene |
| SMILES | C=C/C=C\C(=C/C)CCCCCCC |
| InChI | InChI=1S/C14H24/c1-4-7-9-10-11-13-14(6-3)12-8-5-2/h5-6,8,12H,2,4,7,9-11,13H2,1,3H3/b12-8-,14-6+ |
| InChIKey | OXPSKOMVSQOMFF-MTQWVUDMSA-N |
| XLogP | 5.04 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.35 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|