About 3-ethylideneoct-1-ene
3-ethylideneoct-1-ene (PubChem CID 91511297) has the molecular formula C10H18
and a molecular weight of 138.25 g/mol. Its IUPAC name is 3-ethylideneoct-1-ene.
Molecular Properties
| Compound Name | 3-ethylideneoct-1-ene |
| PubChem CID | 91511297 |
| Molecular Formula | C10H18 |
| Molecular Weight | 138.25 g/mol |
| Exact Mass | 138.14 |
| IUPAC Name | 3-ethylideneoct-1-ene |
| SMILES | C=CC(=CC)CCCCC |
| InChI | InChI=1S/C10H18/c1-4-7-8-9-10(5-2)6-3/h5-6H,2,4,7-9H2,1,3H3 |
| InChIKey | VPKYTMZOXFCYJA-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 138.25 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 3-ethylideneoct-1-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethylideneoct-1-ene?
The IUPAC name of 3-ethylideneoct-1-ene (CID 91511297) is 3-ethylideneoct-1-ene.
What is the SMILES notation for 3-ethylideneoct-1-ene?
The canonical SMILES for 3-ethylideneoct-1-ene is C=CC(=CC)CCCCC.
What is the InChIKey of 3-ethylideneoct-1-ene?
The InChIKey is VPKYTMZOXFCYJA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18/c1-4-7-8-9-10(5-2)6-3/h5-6H,2,4,7-9H2,1,3H3.
What are the key properties of 3-ethylideneoct-1-ene?
3-ethylideneoct-1-ene has a molecular weight of 138.25 g/mol, XLogP of 3.70, 5 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethylideneoct-1-ene is sourced from PubChem (CID 91511297), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).