C11H17F — CID 146517614
(2E,4Z)-5-ethenyl-3-fluoronona-2,4-diene (PubChem CID 146517614) has the molecular formula C11H17F and a molecular weight of 168.25 g/mol. Its IUPAC name is (2E,4Z)-5-ethenyl-3-fluoronona-2,4-diene.
| Compound Name | (2E,4Z)-5-ethenyl-3-fluoronona-2,4-diene |
|---|---|
| PubChem CID | 146517614 |
| Molecular Formula | C11H17F |
| Molecular Weight | 168.25 g/mol |
| Exact Mass | 168.13 |
| IUPAC Name | (2E,4Z)-5-ethenyl-3-fluoronona-2,4-diene |
| SMILES | C=C/C(=C\C(F)=C/C)CCCC |
| InChI | InChI=1S/C11H17F/c1-4-7-8-10(5-2)9-11(12)6-3/h5-6,9H,2,4,7-8H2,1,3H3/b10-9+,11-6+ |
| InChIKey | NSIRRYOPVJITDH-HUJSXLBNSA-N |
| XLogP | 4.16 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.25 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|