About 5-(3-oxonona-1,4-dien-5-yloxy)nona-1,4-dien-3-one
5-(3-oxonona-1,4-dien-5-yloxy)nona-1,4-dien-3-one (PubChem CID 141174155) has the molecular formula C18H26O3
and a molecular weight of 290.40 g/mol. Its IUPAC name is 5-(3-oxonona-1,4-dien-5-yloxy)nona-1,4-dien-3-one.
Molecular Properties
| Compound Name | 5-(3-oxonona-1,4-dien-5-yloxy)nona-1,4-dien-3-one |
| PubChem CID | 141174155 |
| Molecular Formula | C18H26O3 |
| Molecular Weight | 290.40 g/mol |
| Exact Mass | 290.19 |
| IUPAC Name | 5-(3-oxonona-1,4-dien-5-yloxy)nona-1,4-dien-3-one |
| SMILES | C=CC(=O)C=C(CCCC)OC(=CC(=O)C=C)CCCC |
| InChI | InChI=1S/C18H26O3/c1-5-9-11-17(13-15(19)7-3)21-18(12-10-6-2)14-16(20)8-4/h7-8,13-14H,3-6,9-12H2,1-2H3 |
| InChIKey | XTTXLODLZVFZEO-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.40 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 5-(3-oxonona-1,4-dien-5-yloxy)nona-1,4-dien-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(3-oxonona-1,4-dien-5-yloxy)nona-1,4-dien-3-one?
The IUPAC name of 5-(3-oxonona-1,4-dien-5-yloxy)nona-1,4-dien-3-one (CID 141174155) is 5-(3-oxonona-1,4-dien-5-yloxy)nona-1,4-dien-3-one.
What is the SMILES notation for 5-(3-oxonona-1,4-dien-5-yloxy)nona-1,4-dien-3-one?
The canonical SMILES for 5-(3-oxonona-1,4-dien-5-yloxy)nona-1,4-dien-3-one is C=CC(=O)C=C(CCCC)OC(=CC(=O)C=C)CCCC.
What is the InChIKey of 5-(3-oxonona-1,4-dien-5-yloxy)nona-1,4-dien-3-one?
The InChIKey is XTTXLODLZVFZEO-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H26O3/c1-5-9-11-17(13-15(19)7-3)21-18(12-10-6-2)14-16(20)8-4/h7-8,13-14H,3-6,9-12H2,1-2H3.
What are the key properties of 5-(3-oxonona-1,4-dien-5-yloxy)nona-1,4-dien-3-one?
5-(3-oxonona-1,4-dien-5-yloxy)nona-1,4-dien-3-one has a molecular weight of 290.40 g/mol, XLogP of 4.66, 12 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(3-oxonona-1,4-dien-5-yloxy)nona-1,4-dien-3-one is sourced from PubChem (CID 141174155), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).