About 1-iodotridec-1-en-2-yl acetate
1-iodotridec-1-en-2-yl acetate (PubChem CID 173001585) has the molecular formula C15H27IO2
and a molecular weight of 366.28 g/mol. Its IUPAC name is 1-iodotridec-1-en-2-yl acetate.
Molecular Properties
| Compound Name | 1-iodotridec-1-en-2-yl acetate |
| PubChem CID | 173001585 |
| Molecular Formula | C15H27IO2 |
| Molecular Weight | 366.28 g/mol |
| Exact Mass | 366.11 |
| IUPAC Name | 1-iodotridec-1-en-2-yl acetate |
| SMILES | CCCCCCCCCCCC(=CI)OC(C)=O |
| InChI | InChI=1S/C15H27IO2/c1-3-4-5-6-7-8-9-10-11-12-15(13-16)18-14(2)17/h13H,3-12H2,1-2H3 |
| InChIKey | SHNFKLGKKIPETB-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 366.28 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 1-iodotridec-1-en-2-yl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-iodotridec-1-en-2-yl acetate?
The IUPAC name of 1-iodotridec-1-en-2-yl acetate (CID 173001585) is 1-iodotridec-1-en-2-yl acetate.
What is the SMILES notation for 1-iodotridec-1-en-2-yl acetate?
The canonical SMILES for 1-iodotridec-1-en-2-yl acetate is CCCCCCCCCCCC(=CI)OC(C)=O.
What is the InChIKey of 1-iodotridec-1-en-2-yl acetate?
The InChIKey is SHNFKLGKKIPETB-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H27IO2/c1-3-4-5-6-7-8-9-10-11-12-15(13-16)18-14(2)17/h13H,3-12H2,1-2H3.
What are the key properties of 1-iodotridec-1-en-2-yl acetate?
1-iodotridec-1-en-2-yl acetate has a molecular weight of 366.28 g/mol, XLogP of 5.75, 11 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-iodotridec-1-en-2-yl acetate is sourced from PubChem (CID 173001585), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).