About (E)-1,2-diiododec-1-ene
(E)-1,2-diiododec-1-ene (PubChem CID 11361339) has the molecular formula C10H18I2
and a molecular weight of 392.06 g/mol. Its IUPAC name is (E)-1,2-diiododec-1-ene.
Molecular Properties
| Compound Name | (E)-1,2-diiododec-1-ene |
| PubChem CID | 11361339 |
| Molecular Formula | C10H18I2 |
| Molecular Weight | 392.06 g/mol |
| Exact Mass | 391.95 |
| IUPAC Name | (E)-1,2-diiododec-1-ene |
| SMILES | CCCCCCCC/C(I)=C\I |
| InChI | InChI=1S/C10H18I2/c1-2-3-4-5-6-7-8-10(12)9-11/h9H,2-8H2,1H3/b10-9+ |
| InChIKey | QINIPAJOFUPHBF-MDZDMXLPSA-N |
| XLogP | 5.45 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 392.06 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze (E)-1,2-diiododec-1-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-1,2-diiododec-1-ene?
The IUPAC name of (E)-1,2-diiododec-1-ene (CID 11361339) is (E)-1,2-diiododec-1-ene.
What is the SMILES notation for (E)-1,2-diiododec-1-ene?
The canonical SMILES for (E)-1,2-diiododec-1-ene is CCCCCCCC/C(I)=C\I.
What is the InChIKey of (E)-1,2-diiododec-1-ene?
The InChIKey is QINIPAJOFUPHBF-MDZDMXLPSA-N. The full InChI is InChI=1S/C10H18I2/c1-2-3-4-5-6-7-8-10(12)9-11/h9H,2-8H2,1H3/b10-9+.
What are the key properties of (E)-1,2-diiododec-1-ene?
(E)-1,2-diiododec-1-ene has a molecular weight of 392.06 g/mol, XLogP of 5.45, 7 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-1,2-diiododec-1-ene is sourced from PubChem (CID 11361339), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).