About (E)-1,2-dibromohept-1-ene
(E)-1,2-dibromohept-1-ene (PubChem CID 134985754) has the molecular formula C7H12Br2
and a molecular weight of 255.98 g/mol. Its IUPAC name is (E)-1,2-dibromohept-1-ene.
Molecular Properties
| Compound Name | (E)-1,2-dibromohept-1-ene |
| PubChem CID | 134985754 |
| Molecular Formula | C7H12Br2 |
| Molecular Weight | 255.98 g/mol |
| Exact Mass | 253.93 |
| IUPAC Name | (E)-1,2-dibromohept-1-ene |
| SMILES | CCCCC/C(Br)=C\Br |
| InChI | InChI=1S/C7H12Br2/c1-2-3-4-5-7(9)6-8/h6H,2-5H2,1H3/b7-6+ |
| InChIKey | XFDRUDZAWROAIH-VOTSOKGWSA-N |
| XLogP | 4.20 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.98 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (E)-1,2-dibromohept-1-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-1,2-dibromohept-1-ene?
The IUPAC name of (E)-1,2-dibromohept-1-ene (CID 134985754) is (E)-1,2-dibromohept-1-ene.
What is the SMILES notation for (E)-1,2-dibromohept-1-ene?
The canonical SMILES for (E)-1,2-dibromohept-1-ene is CCCCC/C(Br)=C\Br.
What is the InChIKey of (E)-1,2-dibromohept-1-ene?
The InChIKey is XFDRUDZAWROAIH-VOTSOKGWSA-N. The full InChI is InChI=1S/C7H12Br2/c1-2-3-4-5-7(9)6-8/h6H,2-5H2,1H3/b7-6+.
What are the key properties of (E)-1,2-dibromohept-1-ene?
(E)-1,2-dibromohept-1-ene has a molecular weight of 255.98 g/mol, XLogP of 4.20, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-1,2-dibromohept-1-ene is sourced from PubChem (CID 134985754), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).