About hexadecanoyl bromide
hexadecanoyl bromide (PubChem CID 10041615) has the molecular formula C16H31BrO
and a molecular weight of 319.33 g/mol. Its IUPAC name is hexadecanoyl bromide.
Molecular Properties
| Compound Name | hexadecanoyl bromide |
| PubChem CID | 10041615 |
| Molecular Formula | C16H31BrO |
| Molecular Weight | 319.33 g/mol |
| Exact Mass | 318.16 |
| IUPAC Name | hexadecanoyl bromide |
| SMILES | CCCCCCCCCCCCCCCC(=O)Br |
| InChI | InChI=1S/C16H31BrO/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16(17)18/h2-15H2,1H3 |
| InChIKey | YRWYFHQUSMOHMG-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 319.33 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze hexadecanoyl bromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hexadecanoyl bromide?
The IUPAC name of hexadecanoyl bromide (CID 10041615) is hexadecanoyl bromide.
What is the SMILES notation for hexadecanoyl bromide?
The canonical SMILES for hexadecanoyl bromide is CCCCCCCCCCCCCCCC(=O)Br.
What is the InChIKey of hexadecanoyl bromide?
The InChIKey is YRWYFHQUSMOHMG-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H31BrO/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16(17)18/h2-15H2,1H3.
What are the key properties of hexadecanoyl bromide?
hexadecanoyl bromide has a molecular weight of 319.33 g/mol, XLogP of 6.39, 14 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for hexadecanoyl bromide is sourced from PubChem (CID 10041615), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).