About octadecan-4-one
octadecan-4-one (PubChem CID 551672) has the molecular formula C18H36O
and a molecular weight of 268.48 g/mol. Its IUPAC name is octadecan-4-one.
Molecular Properties
| Compound Name | octadecan-4-one |
| PubChem CID | 551672 |
| Molecular Formula | C18H36O |
| Molecular Weight | 268.48 g/mol |
| Exact Mass | 268.28 |
| IUPAC Name | octadecan-4-one |
| SMILES | CCCCCCCCCCCCCCC(=O)CCC |
| InChI | InChI=1S/C18H36O/c1-3-5-6-7-8-9-10-11-12-13-14-15-17-18(19)16-4-2/h3-17H2,1-2H3 |
| InChIKey | UIWQUODMCXBMLX-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 268.48 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze octadecan-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of octadecan-4-one?
The IUPAC name of octadecan-4-one (CID 551672) is octadecan-4-one.
What is the SMILES notation for octadecan-4-one?
The canonical SMILES for octadecan-4-one is CCCCCCCCCCCCCCC(=O)CCC.
What is the InChIKey of octadecan-4-one?
The InChIKey is UIWQUODMCXBMLX-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H36O/c1-3-5-6-7-8-9-10-11-12-13-14-15-17-18(19)16-4-2/h3-17H2,1-2H3.
What are the key properties of octadecan-4-one?
octadecan-4-one has a molecular weight of 268.48 g/mol, XLogP of 6.45, 15 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for octadecan-4-one is sourced from PubChem (CID 551672), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).