About tridecane-4,10-dione
tridecane-4,10-dione (PubChem CID 158766358) has the molecular formula C13H24O2
and a molecular weight of 212.33 g/mol. Its IUPAC name is tridecane-4,10-dione.
Molecular Properties
| Compound Name | tridecane-4,10-dione |
| PubChem CID | 158766358 |
| Molecular Formula | C13H24O2 |
| Molecular Weight | 212.33 g/mol |
| Exact Mass | 212.18 |
| IUPAC Name | tridecane-4,10-dione |
| SMILES | CCCC(=O)CCCCCC(=O)CCC |
| InChI | InChI=1S/C13H24O2/c1-3-8-12(14)10-6-5-7-11-13(15)9-4-2/h3-11H2,1-2H3 |
| InChIKey | IPHRANIHXYGXNX-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.33 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze tridecane-4,10-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tridecane-4,10-dione?
The IUPAC name of tridecane-4,10-dione (CID 158766358) is tridecane-4,10-dione.
What is the SMILES notation for tridecane-4,10-dione?
The canonical SMILES for tridecane-4,10-dione is CCCC(=O)CCCCCC(=O)CCC.
What is the InChIKey of tridecane-4,10-dione?
The InChIKey is IPHRANIHXYGXNX-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H24O2/c1-3-8-12(14)10-6-5-7-11-13(15)9-4-2/h3-11H2,1-2H3.
What are the key properties of tridecane-4,10-dione?
tridecane-4,10-dione has a molecular weight of 212.33 g/mol, XLogP of 3.68, 10 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for tridecane-4,10-dione is sourced from PubChem (CID 158766358), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).