About 1-hydroxyundecane-3,8-dione
1-hydroxyundecane-3,8-dione (PubChem CID 134266398) has the molecular formula C11H20O3
and a molecular weight of 200.28 g/mol. Its IUPAC name is 1-hydroxyundecane-3,8-dione.
Molecular Properties
| Compound Name | 1-hydroxyundecane-3,8-dione |
| PubChem CID | 134266398 |
| Molecular Formula | C11H20O3 |
| Molecular Weight | 200.28 g/mol |
| Exact Mass | 200.14 |
| IUPAC Name | 1-hydroxyundecane-3,8-dione |
| SMILES | CCCC(=O)CCCCC(=O)CCO |
| InChI | InChI=1S/C11H20O3/c1-2-5-10(13)6-3-4-7-11(14)8-9-12/h12H,2-9H2,1H3 |
| InChIKey | VGTKFUQXOOLDAZ-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.28 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-hydroxyundecane-3,8-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-hydroxyundecane-3,8-dione?
The IUPAC name of 1-hydroxyundecane-3,8-dione (CID 134266398) is 1-hydroxyundecane-3,8-dione.
What is the SMILES notation for 1-hydroxyundecane-3,8-dione?
The canonical SMILES for 1-hydroxyundecane-3,8-dione is CCCC(=O)CCCCC(=O)CCO.
What is the InChIKey of 1-hydroxyundecane-3,8-dione?
The InChIKey is VGTKFUQXOOLDAZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20O3/c1-2-5-10(13)6-3-4-7-11(14)8-9-12/h12H,2-9H2,1H3.
What are the key properties of 1-hydroxyundecane-3,8-dione?
1-hydroxyundecane-3,8-dione has a molecular weight of 200.28 g/mol, XLogP of 1.87, 9 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-hydroxyundecane-3,8-dione is sourced from PubChem (CID 134266398), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).