About methanamine;nonan-4-one
methanamine;nonan-4-one (PubChem CID 174439685) has the molecular formula C12H33N3O
and a molecular weight of 235.42 g/mol. Its IUPAC name is methanamine;nonan-4-one.
Molecular Properties
| Compound Name | methanamine;nonan-4-one |
| PubChem CID | 174439685 |
| Molecular Formula | C12H33N3O |
| Molecular Weight | 235.42 g/mol |
| Exact Mass | 235.26 |
| IUPAC Name | methanamine;nonan-4-one |
| SMILES | CCCCCC(=O)CCC.CN.CN.CN |
| InChI | InChI=1S/C9H18O.3CH5N/c1-3-5-6-8-9(10)7-4-2;3*1-2/h3-8H2,1-2H3;3*2H2,1H3 |
| InChIKey | BEAJWDWHPQNHDG-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 95.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.42 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze methanamine;nonan-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methanamine;nonan-4-one?
The IUPAC name of methanamine;nonan-4-one (CID 174439685) is methanamine;nonan-4-one.
What is the SMILES notation for methanamine;nonan-4-one?
The canonical SMILES for methanamine;nonan-4-one is CCCCCC(=O)CCC.CN.CN.CN.
What is the InChIKey of methanamine;nonan-4-one?
The InChIKey is BEAJWDWHPQNHDG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18O.3CH5N/c1-3-5-6-8-9(10)7-4-2;3*1-2/h3-8H2,1-2H3;3*2H2,1H3.
What are the key properties of methanamine;nonan-4-one?
methanamine;nonan-4-one has a molecular weight of 235.42 g/mol, XLogP of 1.66, 6 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methanamine;nonan-4-one is sourced from PubChem (CID 174439685), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).