About 8-aminooctan-4-one
8-aminooctan-4-one (PubChem CID 25202394) has the molecular formula C8H17NO
and a molecular weight of 143.23 g/mol. Its IUPAC name is 8-aminooctan-4-one.
Molecular Properties
| Compound Name | 8-aminooctan-4-one |
| PubChem CID | 25202394 |
| Molecular Formula | C8H17NO |
| Molecular Weight | 143.23 g/mol |
| Exact Mass | 143.13 |
| IUPAC Name | 8-aminooctan-4-one |
| SMILES | CCCC(=O)CCCCN |
| InChI | InChI=1S/C8H17NO/c1-2-5-8(10)6-3-4-7-9/h2-7,9H2,1H3 |
| InChIKey | UYCHPUIDXXFEKR-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 143.23 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 8-aminooctan-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-aminooctan-4-one?
The IUPAC name of 8-aminooctan-4-one (CID 25202394) is 8-aminooctan-4-one.
What is the SMILES notation for 8-aminooctan-4-one?
The canonical SMILES for 8-aminooctan-4-one is CCCC(=O)CCCCN.
What is the InChIKey of 8-aminooctan-4-one?
The InChIKey is UYCHPUIDXXFEKR-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17NO/c1-2-5-8(10)6-3-4-7-9/h2-7,9H2,1H3.
What are the key properties of 8-aminooctan-4-one?
8-aminooctan-4-one has a molecular weight of 143.23 g/mol, XLogP of 1.48, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 8-aminooctan-4-one is sourced from PubChem (CID 25202394), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).