About 10-aminodecan-4-one;piperidine
10-aminodecan-4-one;piperidine (PubChem CID 70631903) has the molecular formula C15H32N2O
and a molecular weight of 256.43 g/mol. Its IUPAC name is 10-aminodecan-4-one;piperidine.
Molecular Properties
| Compound Name | 10-aminodecan-4-one;piperidine |
| PubChem CID | 70631903 |
| Molecular Formula | C15H32N2O |
| Molecular Weight | 256.43 g/mol |
| Exact Mass | 256.25 |
| IUPAC Name | 10-aminodecan-4-one;piperidine |
| SMILES | C1CCNCC1.CCCC(=O)CCCCCCN |
| InChI | InChI=1S/C10H21NO.C5H11N/c1-2-7-10(12)8-5-3-4-6-9-11;1-2-4-6-5-3-1/h2-9,11H2,1H3;6H,1-5H2 |
| InChIKey | NVUUYIGBEGPYCA-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.43 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 10-aminodecan-4-one;piperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 10-aminodecan-4-one;piperidine?
The IUPAC name of 10-aminodecan-4-one;piperidine (CID 70631903) is 10-aminodecan-4-one;piperidine.
What is the SMILES notation for 10-aminodecan-4-one;piperidine?
The canonical SMILES for 10-aminodecan-4-one;piperidine is C1CCNCC1.CCCC(=O)CCCCCCN.
What is the InChIKey of 10-aminodecan-4-one;piperidine?
The InChIKey is NVUUYIGBEGPYCA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H21NO.C5H11N/c1-2-7-10(12)8-5-3-4-6-9-11;1-2-4-6-5-3-1/h2-9,11H2,1H3;6H,1-5H2.
What are the key properties of 10-aminodecan-4-one;piperidine?
10-aminodecan-4-one;piperidine has a molecular weight of 256.43 g/mol, XLogP of 3.02, 8 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 10-aminodecan-4-one;piperidine is sourced from PubChem (CID 70631903), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).