About azepane;dodecanoic acid
azepane;dodecanoic acid (PubChem CID 173452223) has the molecular formula C18H37NO2
and a molecular weight of 299.50 g/mol. Its IUPAC name is azepane;dodecanoic acid.
Molecular Properties
| Compound Name | azepane;dodecanoic acid |
| PubChem CID | 173452223 |
| Molecular Formula | C18H37NO2 |
| Molecular Weight | 299.50 g/mol |
| Exact Mass | 299.28 |
| IUPAC Name | azepane;dodecanoic acid |
| SMILES | C1CCCNCC1.CCCCCCCCCCCC(=O)O |
| InChI | InChI=1S/C12H24O2.C6H13N/c1-2-3-4-5-6-7-8-9-10-11-12(13)14;1-2-4-6-7-5-3-1/h2-11H2,1H3,(H,13,14);7H,1-6H2 |
| InChIKey | AJEMPQPUELYREE-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 299.50 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze azepane;dodecanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azepane;dodecanoic acid?
The IUPAC name of azepane;dodecanoic acid (CID 173452223) is azepane;dodecanoic acid.
What is the SMILES notation for azepane;dodecanoic acid?
The canonical SMILES for azepane;dodecanoic acid is C1CCCNCC1.CCCCCCCCCCCC(=O)O.
What is the InChIKey of azepane;dodecanoic acid?
The InChIKey is AJEMPQPUELYREE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H24O2.C6H13N/c1-2-3-4-5-6-7-8-9-10-11-12(13)14;1-2-4-6-7-5-3-1/h2-11H2,1H3,(H,13,14);7H,1-6H2.
What are the key properties of azepane;dodecanoic acid?
azepane;dodecanoic acid has a molecular weight of 299.50 g/mol, XLogP of 5.14, 10 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for azepane;dodecanoic acid is sourced from PubChem (CID 173452223), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).