About docosanoic acid;tetradecane
docosanoic acid;tetradecane (PubChem CID 157248197) has the molecular formula C36H74O2
and a molecular weight of 538.99 g/mol. Its IUPAC name is docosanoic acid;tetradecane.
Molecular Properties
| Compound Name | docosanoic acid;tetradecane |
| PubChem CID | 157248197 |
| Molecular Formula | C36H74O2 |
| Molecular Weight | 538.99 g/mol |
| Exact Mass | 538.57 |
| IUPAC Name | docosanoic acid;tetradecane |
| SMILES | CCCCCCCCCCCCCC.CCCCCCCCCCCCCCCCCCCCCC(=O)O |
| InChI | InChI=1S/C22H44O2.C14H30/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22(23)24;1-3-5-7-9-11-13-14-12-10-8-6-4-2/h2-21H2,1H3,(H,23,24);3-14H2,1-2H3 |
| InChIKey | AWAMITNKYRVNIA-UHFFFAOYSA-N |
| XLogP | 13.60 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 31 |
| Heavy Atoms | 38 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 538.99 |
| LogP ≤ 5 | 13.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze docosanoic acid;tetradecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of docosanoic acid;tetradecane?
The IUPAC name of docosanoic acid;tetradecane (CID 157248197) is docosanoic acid;tetradecane.
What is the SMILES notation for docosanoic acid;tetradecane?
The canonical SMILES for docosanoic acid;tetradecane is CCCCCCCCCCCCCC.CCCCCCCCCCCCCCCCCCCCCC(=O)O.
What is the InChIKey of docosanoic acid;tetradecane?
The InChIKey is AWAMITNKYRVNIA-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H44O2.C14H30/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22(23)24;1-3-5-7-9-11-13-14-12-10-8-6-4-2/h2-21H2,1H3,(H,23,24);3-14H2,1-2H3.
What are the key properties of docosanoic acid;tetradecane?
docosanoic acid;tetradecane has a molecular weight of 538.99 g/mol, XLogP of 13.60, 31 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for docosanoic acid;tetradecane is sourced from PubChem (CID 157248197), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).