About calcium;dodecanoic acid;hydride
calcium;dodecanoic acid;hydride (PubChem CID 172998116) has the molecular formula C12H26CaO2
and a molecular weight of 242.42 g/mol. Its IUPAC name is calcium;dodecanoic acid;hydride.
Molecular Properties
| Compound Name | calcium;dodecanoic acid;hydride |
| PubChem CID | 172998116 |
| Molecular Formula | C12H26CaO2 |
| Molecular Weight | 242.42 g/mol |
| Exact Mass | 242.16 |
| IUPAC Name | calcium;dodecanoic acid;hydride |
| SMILES | CCCCCCCCCCCC(=O)O.[Ca+2].[H-].[H-] |
| InChI | InChI=1S/C12H24O2.Ca.2H/c1-2-3-4-5-6-7-8-9-10-11-12(13)14;;;/h2-11H2,1H3,(H,13,14);;;/q;+2;2*-1 |
| InChIKey | IOUSDCNXXSYPOA-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.42 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze calcium;dodecanoic acid;hydride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of calcium;dodecanoic acid;hydride?
The IUPAC name of calcium;dodecanoic acid;hydride (CID 172998116) is calcium;dodecanoic acid;hydride.
What is the SMILES notation for calcium;dodecanoic acid;hydride?
The canonical SMILES for calcium;dodecanoic acid;hydride is CCCCCCCCCCCC(=O)O.[Ca+2].[H-].[H-].
What is the InChIKey of calcium;dodecanoic acid;hydride?
The InChIKey is IOUSDCNXXSYPOA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H24O2.Ca.2H/c1-2-3-4-5-6-7-8-9-10-11-12(13)14;;;/h2-11H2,1H3,(H,13,14);;;/q;+2;2*-1.
What are the key properties of calcium;dodecanoic acid;hydride?
calcium;dodecanoic acid;hydride has a molecular weight of 242.42 g/mol, XLogP of 3.84, 10 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for calcium;dodecanoic acid;hydride is sourced from PubChem (CID 172998116), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).