About barium(2+);hydride;tridecanoic acid
barium(2+);hydride;tridecanoic acid (PubChem CID 174792677) has the molecular formula C13H28BaO2
and a molecular weight of 353.69 g/mol. Its IUPAC name is barium(2+);hydride;tridecanoic acid.
Molecular Properties
| Compound Name | barium(2+);hydride;tridecanoic acid |
| PubChem CID | 174792677 |
| Molecular Formula | C13H28BaO2 |
| Molecular Weight | 353.69 g/mol |
| Exact Mass | 354.11 |
| IUPAC Name | barium(2+);hydride;tridecanoic acid |
| SMILES | CCCCCCCCCCCCC(=O)O.[Ba+2].[H-].[H-] |
| InChI | InChI=1S/C13H26O2.Ba.2H/c1-2-3-4-5-6-7-8-9-10-11-12-13(14)15;;;/h2-12H2,1H3,(H,14,15);;;/q;+2;2*-1 |
| InChIKey | FRGAYEIAOKQCJO-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 353.69 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze barium(2+);hydride;tridecanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of barium(2+);hydride;tridecanoic acid?
The IUPAC name of barium(2+);hydride;tridecanoic acid (CID 174792677) is barium(2+);hydride;tridecanoic acid.
What is the SMILES notation for barium(2+);hydride;tridecanoic acid?
The canonical SMILES for barium(2+);hydride;tridecanoic acid is CCCCCCCCCCCCC(=O)O.[Ba+2].[H-].[H-].
What is the InChIKey of barium(2+);hydride;tridecanoic acid?
The InChIKey is FRGAYEIAOKQCJO-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H26O2.Ba.2H/c1-2-3-4-5-6-7-8-9-10-11-12-13(14)15;;;/h2-12H2,1H3,(H,14,15);;;/q;+2;2*-1.
What are the key properties of barium(2+);hydride;tridecanoic acid?
barium(2+);hydride;tridecanoic acid has a molecular weight of 353.69 g/mol, XLogP of 4.23, 11 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for barium(2+);hydride;tridecanoic acid is sourced from PubChem (CID 174792677), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).