About barium(2+);octadecanoic acid
barium(2+);octadecanoic acid (PubChem CID 23045344) has the molecular formula C18H36BaO2+2
and a molecular weight of 421.81 g/mol. Its IUPAC name is barium(2+);octadecanoic acid.
Molecular Properties
| Compound Name | barium(2+);octadecanoic acid |
| PubChem CID | 23045344 |
| Molecular Formula | C18H36BaO2+2 |
| Molecular Weight | 421.81 g/mol |
| Exact Mass | 422.18 |
| IUPAC Name | barium(2+);octadecanoic acid |
| SMILES | CCCCCCCCCCCCCCCCCC(=O)O.[Ba+2] |
| InChI | InChI=1S/C18H36O2.Ba/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;/h2-17H2,1H3,(H,19,20);/q;+2 |
| InChIKey | QQNQUPZIRRGCFP-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 421.81 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze barium(2+);octadecanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of barium(2+);octadecanoic acid?
The IUPAC name of barium(2+);octadecanoic acid (CID 23045344) is barium(2+);octadecanoic acid.
What is the SMILES notation for barium(2+);octadecanoic acid?
The canonical SMILES for barium(2+);octadecanoic acid is CCCCCCCCCCCCCCCCCC(=O)O.[Ba+2].
What is the InChIKey of barium(2+);octadecanoic acid?
The InChIKey is QQNQUPZIRRGCFP-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H36O2.Ba/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;/h2-17H2,1H3,(H,19,20);/q;+2.
What are the key properties of barium(2+);octadecanoic acid?
barium(2+);octadecanoic acid has a molecular weight of 421.81 g/mol, XLogP of 5.95, 16 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for barium(2+);octadecanoic acid is sourced from PubChem (CID 23045344), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).