About 14-aminotetradecan-3-one
14-aminotetradecan-3-one (PubChem CID 178176766) has the molecular formula C14H29NO
and a molecular weight of 227.39 g/mol. Its IUPAC name is 14-aminotetradecan-3-one.
Molecular Properties
| Compound Name | 14-aminotetradecan-3-one |
| PubChem CID | 178176766 |
| Molecular Formula | C14H29NO |
| Molecular Weight | 227.39 g/mol |
| Exact Mass | 227.22 |
| IUPAC Name | 14-aminotetradecan-3-one |
| SMILES | CCC(=O)CCCCCCCCCCCN |
| InChI | InChI=1S/C14H29NO/c1-2-14(16)12-10-8-6-4-3-5-7-9-11-13-15/h2-13,15H2,1H3 |
| InChIKey | XZQYEMPMWXPLCX-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.39 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 14-aminotetradecan-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 14-aminotetradecan-3-one?
The IUPAC name of 14-aminotetradecan-3-one (CID 178176766) is 14-aminotetradecan-3-one.
What is the SMILES notation for 14-aminotetradecan-3-one?
The canonical SMILES for 14-aminotetradecan-3-one is CCC(=O)CCCCCCCCCCCN.
What is the InChIKey of 14-aminotetradecan-3-one?
The InChIKey is XZQYEMPMWXPLCX-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H29NO/c1-2-14(16)12-10-8-6-4-3-5-7-9-11-13-15/h2-13,15H2,1H3.
What are the key properties of 14-aminotetradecan-3-one?
14-aminotetradecan-3-one has a molecular weight of 227.39 g/mol, XLogP of 3.83, 12 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 14-aminotetradecan-3-one is sourced from PubChem (CID 178176766), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).