About methane;undecane-3,9-dione
methane;undecane-3,9-dione (PubChem CID 158816586) has the molecular formula C15H36O2
and a molecular weight of 248.45 g/mol. Its IUPAC name is methane;undecane-3,9-dione.
Molecular Properties
| Compound Name | methane;undecane-3,9-dione |
| PubChem CID | 158816586 |
| Molecular Formula | C15H36O2 |
| Molecular Weight | 248.45 g/mol |
| Exact Mass | 248.27 |
| IUPAC Name | methane;undecane-3,9-dione |
| SMILES | C.C.C.C.CCC(=O)CCCCCC(=O)CC |
| InChI | InChI=1S/C11H20O2.4CH4/c1-3-10(12)8-6-5-7-9-11(13)4-2;;;;/h3-9H2,1-2H3;4*1H4 |
| InChIKey | IVIRMKVOVHGAIT-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 248.45 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze methane;undecane-3,9-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methane;undecane-3,9-dione?
The IUPAC name of methane;undecane-3,9-dione (CID 158816586) is methane;undecane-3,9-dione.
What is the SMILES notation for methane;undecane-3,9-dione?
The canonical SMILES for methane;undecane-3,9-dione is C.C.C.C.CCC(=O)CCCCCC(=O)CC.
What is the InChIKey of methane;undecane-3,9-dione?
The InChIKey is IVIRMKVOVHGAIT-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20O2.4CH4/c1-3-10(12)8-6-5-7-9-11(13)4-2;;;;/h3-9H2,1-2H3;4*1H4.
What are the key properties of methane;undecane-3,9-dione?
methane;undecane-3,9-dione has a molecular weight of 248.45 g/mol, XLogP of 5.44, 8 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methane;undecane-3,9-dione is sourced from PubChem (CID 158816586), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).