About decan-4-one;heptan-3-one
decan-4-one;heptan-3-one (PubChem CID 158463149) has the molecular formula C17H34O2
and a molecular weight of 270.46 g/mol. Its IUPAC name is decan-4-one;heptan-3-one.
Molecular Properties
| Compound Name | decan-4-one;heptan-3-one |
| PubChem CID | 158463149 |
| Molecular Formula | C17H34O2 |
| Molecular Weight | 270.46 g/mol |
| Exact Mass | 270.26 |
| IUPAC Name | decan-4-one;heptan-3-one |
| SMILES | CCCCC(=O)CC.CCCCCCC(=O)CCC |
| InChI | InChI=1S/C10H20O.C7H14O/c1-3-5-6-7-9-10(11)8-4-2;1-3-5-6-7(8)4-2/h3-9H2,1-2H3;3-6H2,1-2H3 |
| InChIKey | HFKVFFATLKSVER-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 270.46 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze decan-4-one;heptan-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of decan-4-one;heptan-3-one?
The IUPAC name of decan-4-one;heptan-3-one (CID 158463149) is decan-4-one;heptan-3-one.
What is the SMILES notation for decan-4-one;heptan-3-one?
The canonical SMILES for decan-4-one;heptan-3-one is CCCCC(=O)CC.CCCCCCC(=O)CCC.
What is the InChIKey of decan-4-one;heptan-3-one?
The InChIKey is HFKVFFATLKSVER-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20O.C7H14O/c1-3-5-6-7-9-10(11)8-4-2;1-3-5-6-7(8)4-2/h3-9H2,1-2H3;3-6H2,1-2H3.
What are the key properties of decan-4-one;heptan-3-one?
decan-4-one;heptan-3-one has a molecular weight of 270.46 g/mol, XLogP of 5.48, 11 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for decan-4-one;heptan-3-one is sourced from PubChem (CID 158463149), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).