About hexadecane-3,6-dione
hexadecane-3,6-dione (PubChem CID 154449726) has the molecular formula C16H30O2
and a molecular weight of 254.41 g/mol. Its IUPAC name is hexadecane-3,6-dione.
Molecular Properties
| Compound Name | hexadecane-3,6-dione |
| PubChem CID | 154449726 |
| Molecular Formula | C16H30O2 |
| Molecular Weight | 254.41 g/mol |
| Exact Mass | 254.22 |
| IUPAC Name | hexadecane-3,6-dione |
| SMILES | CCCCCCCCCCC(=O)CCC(=O)CC |
| InChI | InChI=1S/C16H30O2/c1-3-5-6-7-8-9-10-11-12-16(18)14-13-15(17)4-2/h3-14H2,1-2H3 |
| InChIKey | JRZVYBMKJJZHNK-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.41 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze hexadecane-3,6-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hexadecane-3,6-dione?
The IUPAC name of hexadecane-3,6-dione (CID 154449726) is hexadecane-3,6-dione.
What is the SMILES notation for hexadecane-3,6-dione?
The canonical SMILES for hexadecane-3,6-dione is CCCCCCCCCCC(=O)CCC(=O)CC.
What is the InChIKey of hexadecane-3,6-dione?
The InChIKey is JRZVYBMKJJZHNK-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H30O2/c1-3-5-6-7-8-9-10-11-12-16(18)14-13-15(17)4-2/h3-14H2,1-2H3.
What are the key properties of hexadecane-3,6-dione?
hexadecane-3,6-dione has a molecular weight of 254.41 g/mol, XLogP of 4.85, 13 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for hexadecane-3,6-dione is sourced from PubChem (CID 154449726), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).