About N-methylmethanamine;octan-3-one
N-methylmethanamine;octan-3-one (PubChem CID 174828538) has the molecular formula C10H23NO
and a molecular weight of 173.30 g/mol. Its IUPAC name is N-methylmethanamine;octan-3-one.
Molecular Properties
| Compound Name | N-methylmethanamine;octan-3-one |
| PubChem CID | 174828538 |
| Molecular Formula | C10H23NO |
| Molecular Weight | 173.30 g/mol |
| Exact Mass | 173.18 |
| IUPAC Name | N-methylmethanamine;octan-3-one |
| SMILES | CCCCCC(=O)CC.CNC |
| InChI | InChI=1S/C8H16O.C2H7N/c1-3-5-6-7-8(9)4-2;1-3-2/h3-7H2,1-2H3;3H,1-2H3 |
| InChIKey | HTMCJKLCTUJAHZ-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.30 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-methylmethanamine;octan-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methylmethanamine;octan-3-one?
The IUPAC name of N-methylmethanamine;octan-3-one (CID 174828538) is N-methylmethanamine;octan-3-one.
What is the SMILES notation for N-methylmethanamine;octan-3-one?
The canonical SMILES for N-methylmethanamine;octan-3-one is CCCCCC(=O)CC.CNC.
What is the InChIKey of N-methylmethanamine;octan-3-one?
The InChIKey is HTMCJKLCTUJAHZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16O.C2H7N/c1-3-5-6-7-8(9)4-2;1-3-2/h3-7H2,1-2H3;3H,1-2H3.
What are the key properties of N-methylmethanamine;octan-3-one?
N-methylmethanamine;octan-3-one has a molecular weight of 173.30 g/mol, XLogP of 2.38, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-methylmethanamine;octan-3-one is sourced from PubChem (CID 174828538), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).