About decan-3-one;hydrochloride
decan-3-one;hydrochloride (PubChem CID 22446547) has the molecular formula C10H21ClO
and a molecular weight of 192.73 g/mol. Its IUPAC name is decan-3-one;hydrochloride.
Molecular Properties
| Compound Name | decan-3-one;hydrochloride |
| PubChem CID | 22446547 |
| Molecular Formula | C10H21ClO |
| Molecular Weight | 192.73 g/mol |
| Exact Mass | 192.13 |
| IUPAC Name | decan-3-one;hydrochloride |
| SMILES | CCCCCCCC(=O)CC.Cl |
| InChI | InChI=1S/C10H20O.ClH/c1-3-5-6-7-8-9-10(11)4-2;/h3-9H2,1-2H3;1H |
| InChIKey | XGVAVYFUTNYHMY-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.73 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze decan-3-one;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of decan-3-one;hydrochloride?
The IUPAC name of decan-3-one;hydrochloride (CID 22446547) is decan-3-one;hydrochloride.
What is the SMILES notation for decan-3-one;hydrochloride?
The canonical SMILES for decan-3-one;hydrochloride is CCCCCCCC(=O)CC.Cl.
What is the InChIKey of decan-3-one;hydrochloride?
The InChIKey is XGVAVYFUTNYHMY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20O.ClH/c1-3-5-6-7-8-9-10(11)4-2;/h3-9H2,1-2H3;1H.
What are the key properties of decan-3-one;hydrochloride?
decan-3-one;hydrochloride has a molecular weight of 192.73 g/mol, XLogP of 3.75, 7 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for decan-3-one;hydrochloride is sourced from PubChem (CID 22446547), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).